C20H25NO3S — CID 87348790
(5Z)-3-(1-cyclohexylethyl)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87348790) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (5Z)-3-(1-cyclohexylethyl)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(1-cyclohexylethyl)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87348790 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (5Z)-3-(1-cyclohexylethyl)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2\SC(=O)N(C(C)C3CCCCC3)C2=O)cc(C)c1O |
| InChI | InChI=1S/C20H25NO3S/c1-12-9-15(10-13(2)18(12)22)11-17-19(23)21(20(24)25-17)14(3)16-7-5-4-6-8-16/h9-11,14,16,22H,4-8H2,1-3H3/b17-11- |
| InChIKey | MBQDNLLCKCRUQJ-BOPFTXTBSA-N |
| XLogP | 5.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|