C26H30N2O6S2 — CID 173061880
N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 173061880) has the molecular formula C26H30N2O6S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 173061880 |
| Molecular Formula | C26H30N2O6S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[4-[[3-(1-cyclohexylethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C=C3SC(=O)N(C(C)C4CCCCC4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C26H30N2O6S2/c1-17(19-7-5-4-6-8-19)28-25(29)24(35-26(28)30)15-18-9-11-20(12-10-18)27-36(31,32)21-13-14-22(33-2)23(16-21)34-3/h9-17,19,27H,4-8H2,1-3H3 |
| InChIKey | KICNKHHQUFOPOV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|