C18H19Br2NO2S — CID 87274849
(5Z)-3-(1-cyclohexylethyl)-5-[(3,5-dibromophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87274849) has the molecular formula C18H19Br2NO2S and a molecular weight of 473.23 g/mol. Its IUPAC name is (5Z)-3-(1-cyclohexylethyl)-5-[(3,5-dibromophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(1-cyclohexylethyl)-5-[(3,5-dibromophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87274849 |
| Molecular Formula | C18H19Br2NO2S |
| Molecular Weight | 473.23 g/mol |
| Exact Mass | 470.95 |
| IUPAC Name | (5Z)-3-(1-cyclohexylethyl)-5-[(3,5-dibromophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C1CCCCC1)N1C(=O)S/C(=C\c2cc(Br)cc(Br)c2)C1=O |
| InChI | InChI=1S/C18H19Br2NO2S/c1-11(13-5-3-2-4-6-13)21-17(22)16(24-18(21)23)9-12-7-14(19)10-15(20)8-12/h7-11,13H,2-6H2,1H3/b16-9- |
| InChIKey | ZMYNJRXWZOCQCB-SXGWCWSVSA-N |
| XLogP | 6.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.23 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|