C19H24F3I2N3Pt — CID 87352489
N,N-diiodocycloheptanamine;[1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-ylidene]platinum (PubChem CID 87352489) has the molecular formula C19H24F3I2N3Pt and a molecular weight of 800.30 g/mol. Its IUPAC name is N,N-diiodocycloheptanamine;[1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-ylidene]platinum.
| Compound Name | N,N-diiodocycloheptanamine;[1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 87352489 |
| Molecular Formula | C19H24F3I2N3Pt |
| Molecular Weight | 800.30 g/mol |
| Exact Mass | 799.97 |
| IUPAC Name | N,N-diiodocycloheptanamine;[1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazol-2-ylidene]platinum |
| SMILES | Cn1ccn(Cc2cccc(C(F)(F)F)c2)c1=[Pt].IN(I)C1CCCCCC1 |
| InChI | InChI=1S/C12H11F3N2.C7H13I2N.Pt/c1-16-5-6-17(9-16)8-10-3-2-4-11(7-10)12(13,14)15;8-10(9)7-5-3-1-2-4-6-7;/h2-7H,8H2,1H3;7H,1-6H2; |
| InChIKey | GJJZFPGLAKMQBX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.30 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|