C26H38N6O3S — CID 87353382
ethyl 2-[[9-cyclohexyl-4-(4-hydroxypiperidin-1-yl)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 87353382) has the molecular formula C26H38N6O3S and a molecular weight of 514.70 g/mol. Its IUPAC name is ethyl 2-[[9-cyclohexyl-4-(4-hydroxypiperidin-1-yl)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[9-cyclohexyl-4-(4-hydroxypiperidin-1-yl)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 87353382 |
| Molecular Formula | C26H38N6O3S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | ethyl 2-[[9-cyclohexyl-4-(4-hydroxypiperidin-1-yl)-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc(N3CCC(O)CC3)c3c(n2)N(C2CCCCC2)CCCC3)nc1C |
| InChI | InChI=1S/C26H38N6O3S/c1-3-35-24(34)21-17(2)27-26(36-21)30-25-28-22(31-15-12-19(33)13-16-31)20-11-7-8-14-32(23(20)29-25)18-9-5-4-6-10-18/h18-19,33H,3-16H2,1-2H3,(H,27,28,29,30) |
| InChIKey | QHFAYTQRKHTRBJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |