C27H35N7O5S2 — CID 10054338
ethyl 2-[[4-(4-hydroxypiperidin-1-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 10054338) has the molecular formula C27H35N7O5S2 and a molecular weight of 601.76 g/mol. Its IUPAC name is ethyl 2-[[4-(4-hydroxypiperidin-1-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[4-(4-hydroxypiperidin-1-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 10054338 |
| Molecular Formula | C27H35N7O5S2 |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | ethyl 2-[[4-(4-hydroxypiperidin-1-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc(N3CCC(O)CC3)c3c(n2)N(Cc2ccc(S(N)(=O)=O)cc2)CCCC3)nc1C |
| InChI | InChI=1S/C27H35N7O5S2/c1-3-39-25(36)22-17(2)29-27(40-22)32-26-30-23(33-14-11-19(35)12-15-33)21-6-4-5-13-34(24(21)31-26)16-18-7-9-20(10-8-18)41(28,37)38/h7-10,19,35H,3-6,11-16H2,1-2H3,(H2,28,37,38)(H,29,30,31,32) |
| InChIKey | PVZHPRINQKEKJE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |