C28H37N7O5S2 — CID 87353493
ethyl 2-[[4-(2,6-dimethylmorpholin-4-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 87353493) has the molecular formula C28H37N7O5S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is ethyl 2-[[4-(2,6-dimethylmorpholin-4-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[4-(2,6-dimethylmorpholin-4-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 87353493 |
| Molecular Formula | C28H37N7O5S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | ethyl 2-[[4-(2,6-dimethylmorpholin-4-yl)-9-[(4-sulfamoylphenyl)methyl]-5,6,7,8-tetrahydropyrimido[4,5-b]azepin-2-yl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc3c(c(N4CC(C)OC(C)C4)n2)CCCCN3Cc2ccc(S(N)(=O)=O)cc2)nc1C |
| InChI | InChI=1S/C28H37N7O5S2/c1-5-39-26(36)23-19(4)30-28(41-23)33-27-31-24-22(25(32-27)35-14-17(2)40-18(3)15-35)8-6-7-13-34(24)16-20-9-11-21(12-10-20)42(29,37)38/h9-12,17-18H,5-8,13-16H2,1-4H3,(H2,29,37,38)(H,30,31,32,33) |
| InChIKey | CEVKBDBJGDYIKC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |