C22H49NO5P2 — CID 87357861
N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine (PubChem CID 87357861) has the molecular formula C22H49NO5P2 and a molecular weight of 469.58 g/mol. Its IUPAC name is N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine.
| Compound Name | N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 87357861 |
| Molecular Formula | C22H49NO5P2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine |
| SMILES | CCOC(C)(OCC)PCCN(CCPC(C)(OCC)OCC)C(CC)OC(C)C |
| InChI | InChI=1S/C22H49NO5P2/c1-10-20(28-19(6)7)23(15-17-29-21(8,24-11-2)25-12-3)16-18-30-22(9,26-13-4)27-14-5/h19-20,29-30H,10-18H2,1-9H3 |
| InChIKey | DIKXEXPVQSZJII-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|