About N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine
N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine (PubChem CID 87357861) has the molecular formula C22H49NO5P2
and a molecular weight of 469.58 g/mol. Its IUPAC name is N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine.
Molecular Properties
| Compound Name | N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine |
| PubChem CID | 87357861 |
| Molecular Formula | C22H49NO5P2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine |
| SMILES | CCOC(C)(OCC)PCCN(CCPC(C)(OCC)OCC)C(CC)OC(C)C |
| InChI | InChI=1S/C22H49NO5P2/c1-10-20(28-19(6)7)23(15-17-29-21(8,24-11-2)25-12-3)16-18-30-22(9,26-13-4)27-14-5/h19-20,29-30H,10-18H2,1-9H3 |
| InChIKey | DIKXEXPVQSZJII-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine?
The IUPAC name of N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine (CID 87357861) is N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine.
What is the SMILES notation for N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine?
The canonical SMILES for N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine is CCOC(C)(OCC)PCCN(CCPC(C)(OCC)OCC)C(CC)OC(C)C.
What is the InChIKey of N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine?
The InChIKey is DIKXEXPVQSZJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H49NO5P2/c1-10-20(28-19(6)7)23(15-17-29-21(8,24-11-2)25-12-3)16-18-30-22(9,26-13-4)27-14-5/h19-20,29-30H,10-18H2,1-9H3.
What are the key properties of N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine?
N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine has a molecular weight of 469.58 g/mol, XLogP of 5.30, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[2-(1,1-diethoxyethylphosphanyl)ethyl]-1-propan-2-yloxypropan-1-amine is sourced from PubChem (CID 87357861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).