C19H43NO5P2 — CID 87358090
N,N-bis[1-(1,1-dimethoxypropylphosphanyl)ethyl]-1-ethoxypropan-1-amine (PubChem CID 87358090) has the molecular formula C19H43NO5P2 and a molecular weight of 427.50 g/mol. Its IUPAC name is N,N-bis[1-(1,1-dimethoxypropylphosphanyl)ethyl]-1-ethoxypropan-1-amine.
| Compound Name | N,N-bis[1-(1,1-dimethoxypropylphosphanyl)ethyl]-1-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 87358090 |
| Molecular Formula | C19H43NO5P2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N,N-bis[1-(1,1-dimethoxypropylphosphanyl)ethyl]-1-ethoxypropan-1-amine |
| SMILES | CCOC(CC)N(C(C)PC(CC)(OC)OC)C(C)PC(CC)(OC)OC |
| InChI | InChI=1S/C19H43NO5P2/c1-11-17(25-14-4)20(15(5)26-18(12-2,21-7)22-8)16(6)27-19(13-3,23-9)24-10/h15-17,26-27H,11-14H2,1-10H3 |
| InChIKey | JUKDATSEMWIOMM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|