C28H61NO5P2 — CID 87357498
N,N-bis[2-(1,1-dipropoxypropylphosphanyl)ethyl]-1-propoxypropan-1-amine (PubChem CID 87357498) has the molecular formula C28H61NO5P2 and a molecular weight of 553.75 g/mol. Its IUPAC name is N,N-bis[2-(1,1-dipropoxypropylphosphanyl)ethyl]-1-propoxypropan-1-amine.
| Compound Name | N,N-bis[2-(1,1-dipropoxypropylphosphanyl)ethyl]-1-propoxypropan-1-amine |
|---|---|
| PubChem CID | 87357498 |
| Molecular Formula | C28H61NO5P2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.40 |
| IUPAC Name | N,N-bis[2-(1,1-dipropoxypropylphosphanyl)ethyl]-1-propoxypropan-1-amine |
| SMILES | CCCOC(CC)N(CCPC(CC)(OCCC)OCCC)CCPC(CC)(OCCC)OCCC |
| InChI | InChI=1S/C28H61NO5P2/c1-9-19-30-26(14-6)29(17-24-35-27(15-7,31-20-10-2)32-21-11-3)18-25-36-28(16-8,33-22-12-4)34-23-13-5/h26,35-36H,9-25H2,1-8H3 |
| InChIKey | YQIICFZDDCDIAR-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|