C13H31NO7P2 — CID 87357786
[2-[1-ethoxypropyl-(2-methyl-1-phosphonopropan-2-yl)amino]-2-methylpropyl]phosphonic acid (PubChem CID 87357786) has the molecular formula C13H31NO7P2 and a molecular weight of 375.34 g/mol. Its IUPAC name is [2-[1-ethoxypropyl-(2-methyl-1-phosphonopropan-2-yl)amino]-2-methylpropyl]phosphonic acid.
| Compound Name | [2-[1-ethoxypropyl-(2-methyl-1-phosphonopropan-2-yl)amino]-2-methylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 87357786 |
| Molecular Formula | C13H31NO7P2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[1-ethoxypropyl-(2-methyl-1-phosphonopropan-2-yl)amino]-2-methylpropyl]phosphonic acid |
| SMILES | CCOC(CC)N(C(C)(C)CP(=O)(O)O)C(C)(C)CP(=O)(O)O |
| InChI | InChI=1S/C13H31NO7P2/c1-7-11(21-8-2)14(12(3,4)9-22(15,16)17)13(5,6)10-23(18,19)20/h11H,7-10H2,1-6H3,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | NUTYRDWPBUWGLK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|