C14H33O6PSi — CID 174895590
(2-propyl-2-triethoxysilylpentyl)phosphonic acid (PubChem CID 174895590) has the molecular formula C14H33O6PSi and a molecular weight of 356.47 g/mol. Its IUPAC name is (2-propyl-2-triethoxysilylpentyl)phosphonic acid.
| Compound Name | (2-propyl-2-triethoxysilylpentyl)phosphonic acid |
|---|---|
| PubChem CID | 174895590 |
| Molecular Formula | C14H33O6PSi |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2-propyl-2-triethoxysilylpentyl)phosphonic acid |
| SMILES | CCCC(CCC)(CP(=O)(O)O)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H33O6PSi/c1-6-11-14(12-7-2,13-21(15,16)17)22(18-8-3,19-9-4)20-10-5/h6-13H2,1-5H3,(H2,15,16,17) |
| InChIKey | NLXGKQOUVWEJPK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|