C12H28NO4P — CID 87134430
(2-amino-1-hydroxy-2-pentylheptyl)phosphonic acid (PubChem CID 87134430) has the molecular formula C12H28NO4P and a molecular weight of 281.33 g/mol. Its IUPAC name is (2-amino-1-hydroxy-2-pentylheptyl)phosphonic acid.
| Compound Name | (2-amino-1-hydroxy-2-pentylheptyl)phosphonic acid |
|---|---|
| PubChem CID | 87134430 |
| Molecular Formula | C12H28NO4P |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2-amino-1-hydroxy-2-pentylheptyl)phosphonic acid |
| SMILES | CCCCCC(N)(CCCCC)C(O)P(=O)(O)O |
| InChI | InChI=1S/C12H28NO4P/c1-3-5-7-9-12(13,10-8-6-4-2)11(14)18(15,16)17/h11,14H,3-10,13H2,1-2H3,(H2,15,16,17) |
| InChIKey | QUEXTLRFAKGGRI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|