C16H24ClN5O4 — CID 87359152
(dicarbamoylamino) 1-[[4-(methylaminomethyl)phenyl]methyl]pyrrolidine-3-carboxylate;hydrochloride (PubChem CID 87359152) has the molecular formula C16H24ClN5O4 and a molecular weight of 385.85 g/mol. Its IUPAC name is (dicarbamoylamino) 1-[[4-(methylaminomethyl)phenyl]methyl]pyrrolidine-3-carboxylate;hydrochloride.
| Compound Name | (dicarbamoylamino) 1-[[4-(methylaminomethyl)phenyl]methyl]pyrrolidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 87359152 |
| Molecular Formula | C16H24ClN5O4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (dicarbamoylamino) 1-[[4-(methylaminomethyl)phenyl]methyl]pyrrolidine-3-carboxylate;hydrochloride |
| SMILES | CNCc1ccc(CN2CCC(C(=O)ON(C(N)=O)C(N)=O)C2)cc1.Cl |
| InChI | InChI=1S/C16H23N5O4.ClH/c1-19-8-11-2-4-12(5-3-11)9-20-7-6-13(10-20)14(22)25-21(15(17)23)16(18)24;/h2-5,13,19H,6-10H2,1H3,(H2,17,23)(H2,18,24);1H |
| InChIKey | SUSUECVVBQZWND-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|