C5H12N2O2S2 — CID 87369719
(2S)-2,3-diamino-4-methylsulfanyl-4-sulfanylbutanoic acid (PubChem CID 87369719) has the molecular formula C5H12N2O2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is (2S)-2,3-diamino-4-methylsulfanyl-4-sulfanylbutanoic acid.
| Compound Name | (2S)-2,3-diamino-4-methylsulfanyl-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 87369719 |
| Molecular Formula | C5H12N2O2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (2S)-2,3-diamino-4-methylsulfanyl-4-sulfanylbutanoic acid |
| SMILES | CSC(S)C(N)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2S2/c1-11-5(10)3(7)2(6)4(8)9/h2-3,5,10H,6-7H2,1H3,(H,8,9)/t2-,3?,5?/m0/s1 |
| InChIKey | XDDQYSODEOEJGH-GNKMETOCSA-N |
| XLogP | -0.66 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|