C29H30N5O3+ — CID 87370640
N-[2-methoxy-4-[4-methyl-1-(oxan-4-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenyl]-1-methylindole-2-carboxamide (PubChem CID 87370640) has the molecular formula C29H30N5O3+ and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[2-methoxy-4-[4-methyl-1-(oxan-4-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[2-methoxy-4-[4-methyl-1-(oxan-4-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 87370640 |
| Molecular Formula | C29H30N5O3+ |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[2-methoxy-4-[4-methyl-1-(oxan-4-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenyl]-1-methylindole-2-carboxamide |
| SMILES | COc1cc(C2=NC(C3CCOCC3)=C3C=NC=C[N+]23C)ccc1NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C29H29N5O3/c1-33-23-7-5-4-6-20(23)16-24(33)29(35)31-22-9-8-21(17-26(22)36-3)28-32-27(19-10-14-37-15-11-19)25-18-30-12-13-34(25,28)2/h4-9,12-13,16-19H,10-11,14-15H2,1-3H3/p+1 |
| InChIKey | PYBOZIWEXWYEAT-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|