C22H27N6O4+ — CID 123564736
[4-[1-[1-(2-aminoacetyl)piperidin-4-yl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-2-methoxyphenyl]carbamic acid (PubChem CID 123564736) has the molecular formula C22H27N6O4+ and a molecular weight of 439.50 g/mol. Its IUPAC name is [4-[1-[1-(2-aminoacetyl)piperidin-4-yl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-2-methoxyphenyl]carbamic acid.
| Compound Name | [4-[1-[1-(2-aminoacetyl)piperidin-4-yl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-2-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 123564736 |
| Molecular Formula | C22H27N6O4+ |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [4-[1-[1-(2-aminoacetyl)piperidin-4-yl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-2-methoxyphenyl]carbamic acid |
| SMILES | COc1cc(C2=NC(C3CCN(C(=O)CN)CC3)=C3C=NC=C[N+]23C)ccc1NC(=O)O |
| InChI | InChI=1S/C22H26N6O4/c1-28-10-7-24-13-17(28)20(14-5-8-27(9-6-14)19(29)12-23)26-21(28)15-3-4-16(25-22(30)31)18(11-15)32-2/h3-4,7,10-11,13-14H,5-6,8-9,12,23H2,1-2H3,(H-,24,25,26,30,31)/p+1 |
| InChIKey | IEGZEYSSVILRFD-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|