C27H28F2N5O2+ — CID 87391245
4-[4-amino-3-[3-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-methylcyclohexane-1-carboxamide (PubChem CID 87391245) has the molecular formula C27H28F2N5O2+ and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-[4-amino-3-[3-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 4-[4-amino-3-[3-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87391245 |
| Molecular Formula | C27H28F2N5O2+ |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[4-amino-3-[3-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1CCC(C2=C3C=NC=C[N+]3(N)C(c3cccc(OCc4c(F)cccc4F)c3)=N2)CC1 |
| InChI | InChI=1S/C27H27F2N5O2/c1-31-27(35)18-10-8-17(9-11-18)25-24-15-32-12-13-34(24,30)26(33-25)19-4-2-5-20(14-19)36-16-21-22(28)6-3-7-23(21)29/h2-7,12-15,17-18H,8-11,16,30H2,1H3/p+1 |
| InChIKey | RUDIFCZFNMBCTM-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|