C29H34N5O+ — CID 87391197
1-[3-[(2-methylpyrrolidin-1-yl)methyl]cyclobutyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87391197) has the molecular formula C29H34N5O+ and a molecular weight of 468.63 g/mol. Its IUPAC name is 1-[3-[(2-methylpyrrolidin-1-yl)methyl]cyclobutyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-[3-[(2-methylpyrrolidin-1-yl)methyl]cyclobutyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87391197 |
| Molecular Formula | C29H34N5O+ |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 1-[3-[(2-methylpyrrolidin-1-yl)methyl]cyclobutyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CC1CCCN1CC1CC(C2=C3C=NC=C[N+]3(N)C(c3cccc(OCc4ccccc4)c3)=N2)C1 |
| InChI | InChI=1S/C29H34N5O/c1-21-7-6-13-33(21)19-23-15-25(16-23)28-27-18-31-12-14-34(27,30)29(32-28)24-10-5-11-26(17-24)35-20-22-8-3-2-4-9-22/h2-5,8-12,14,17-18,21,23,25H,6-7,13,15-16,19-20,30H2,1H3/q+1 |
| InChIKey | QRFQBFVIQOSVFC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|