C33H36N5O+ — CID 87391716
1-[4-[(benzylamino)methyl]cyclohexyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87391716) has the molecular formula C33H36N5O+ and a molecular weight of 518.69 g/mol. Its IUPAC name is 1-[4-[(benzylamino)methyl]cyclohexyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-[4-[(benzylamino)methyl]cyclohexyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87391716 |
| Molecular Formula | C33H36N5O+ |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 1-[4-[(benzylamino)methyl]cyclohexyl]-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | N[N+]12C=CN=CC1=C(C1CCC(CNCc3ccccc3)CC1)N=C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H36N5O/c34-38-19-18-35-23-31(38)32(28-16-14-26(15-17-28)22-36-21-25-8-3-1-4-9-25)37-33(38)29-12-7-13-30(20-29)39-24-27-10-5-2-6-11-27/h1-13,18-20,23,26,28,36H,14-17,21-22,24,34H2/q+1 |
| InChIKey | VQFRLUARNHWJGM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|