C31H37N6O2+ — CID 87391163
[4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 87391163) has the molecular formula C31H37N6O2+ and a molecular weight of 525.68 g/mol. Its IUPAC name is [4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 87391163 |
| Molecular Formula | C31H37N6O2+ |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | [4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2CCC(C3=C4C=NC=C[N+]4(N)C(c4cccc(OCc5ccccc5)c4)=N3)CC2)CC1 |
| InChI | InChI=1S/C31H37N6O2/c1-35-15-17-36(18-16-35)31(38)25-12-10-24(11-13-25)29-28-21-33-14-19-37(28,32)30(34-29)26-8-5-9-27(20-26)39-22-23-6-3-2-4-7-23/h2-9,14,19-21,24-25H,10-13,15-18,22,32H2,1H3/q+1 |
| InChIKey | YALNQSWNALBEBZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|