C27H32N5O+ — CID 87391861
3-(3-phenylmethoxyphenyl)-1-[3-[(propan-2-ylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87391861) has the molecular formula C27H32N5O+ and a molecular weight of 442.59 g/mol. Its IUPAC name is 3-(3-phenylmethoxyphenyl)-1-[3-[(propan-2-ylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(3-phenylmethoxyphenyl)-1-[3-[(propan-2-ylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87391861 |
| Molecular Formula | C27H32N5O+ |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3-(3-phenylmethoxyphenyl)-1-[3-[(propan-2-ylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CC(C)NCC1CC(C2=C3C=NC=C[N+]3(N)C(c3cccc(OCc4ccccc4)c3)=N2)C1 |
| InChI | InChI=1S/C27H32N5O/c1-19(2)30-16-21-13-23(14-21)26-25-17-29-11-12-32(25,28)27(31-26)22-9-6-10-24(15-22)33-18-20-7-4-3-5-8-20/h3-12,15,17,19,21,23,30H,13-14,16,18,28H2,1-2H3/q+1 |
| InChIKey | KJFFHFNTXMSSCV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|