C31H41N6O+ — CID 87391530
N'-[[4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]methyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 87391530) has the molecular formula C31H41N6O+ and a molecular weight of 513.71 g/mol. Its IUPAC name is N'-[[4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]methyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[[4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 87391530 |
| Molecular Formula | C31H41N6O+ |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | N'-[[4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexyl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)CC1CCC(C2=C3C=NC=C[N+]3(N)C(c3cccc(OCc4ccccc4)c3)=N2)CC1 |
| InChI | InChI=1S/C31H41N6O/c1-35(2)17-18-36(3)22-24-12-14-26(15-13-24)30-29-21-33-16-19-37(29,32)31(34-30)27-10-7-11-28(20-27)38-23-25-8-5-4-6-9-25/h4-11,16,19-21,24,26H,12-15,17-18,22-23,32H2,1-3H3/q+1 |
| InChIKey | JQDGBIGWSGBIEV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|