C29H36N5O+ — CID 87391283
3-(3-phenylmethoxyphenyl)-1-[4-(propylaminomethyl)cyclohexyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87391283) has the molecular formula C29H36N5O+ and a molecular weight of 470.64 g/mol. Its IUPAC name is 3-(3-phenylmethoxyphenyl)-1-[4-(propylaminomethyl)cyclohexyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(3-phenylmethoxyphenyl)-1-[4-(propylaminomethyl)cyclohexyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87391283 |
| Molecular Formula | C29H36N5O+ |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 3-(3-phenylmethoxyphenyl)-1-[4-(propylaminomethyl)cyclohexyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CCCNCC1CCC(C2=C3C=NC=C[N+]3(N)C(c3cccc(OCc4ccccc4)c3)=N2)CC1 |
| InChI | InChI=1S/C29H36N5O/c1-2-15-31-19-22-11-13-24(14-12-22)28-27-20-32-16-17-34(27,30)29(33-28)25-9-6-10-26(18-25)35-21-23-7-4-3-5-8-23/h3-10,16-18,20,22,24,31H,2,11-15,19,21,30H2,1H3/q+1 |
| InChIKey | PPSLVTQCZSZKSG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|