C20H18N5O2+ — CID 87539151
4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-carboxamide (PubChem CID 87539151) has the molecular formula C20H18N5O2+ and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-carboxamide.
| Compound Name | 4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 87539151 |
| Molecular Formula | C20H18N5O2+ |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-carboxamide |
| SMILES | NC(=O)C1=C2C=NC=C[N+]2(N)C(c2cccc(OCc3ccccc3)c2)=N1 |
| InChI | InChI=1S/C20H17N5O2/c21-19(26)18-17-12-23-9-10-25(17,22)20(24-18)15-7-4-8-16(11-15)27-13-14-5-2-1-3-6-14/h1-12H,13,22H2,(H-,21,26)/p+1 |
| InChIKey | MHMKGVKJPSPZBD-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|