C26H23N4O+ — CID 87390899
1-benzyl-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87390899) has the molecular formula C26H23N4O+ and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-benzyl-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-benzyl-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87390899 |
| Molecular Formula | C26H23N4O+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-benzyl-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | N[N+]12C=CN=CC1=C(Cc1ccccc1)N=C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H23N4O/c27-30-15-14-28-18-25(30)24(16-20-8-3-1-4-9-20)29-26(30)22-12-7-13-23(17-22)31-19-21-10-5-2-6-11-21/h1-15,17-18H,16,19,27H2/q+1 |
| InChIKey | YJMDISWVBQOQDO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|