C29H32N5O2+ — CID 87391399
4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-cyclopropylcyclohexane-1-carboxamide (PubChem CID 87391399) has the molecular formula C29H32N5O2+ and a molecular weight of 482.61 g/mol. Its IUPAC name is 4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-cyclopropylcyclohexane-1-carboxamide.
| Compound Name | 4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-cyclopropylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87391399 |
| Molecular Formula | C29H32N5O2+ |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 4-[4-amino-3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-N-cyclopropylcyclohexane-1-carboxamide |
| SMILES | N[N+]12C=CN=CC1=C(C1CCC(C(=O)NC3CC3)CC1)N=C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H31N5O2/c30-34-16-15-31-18-26(34)27(21-9-11-22(12-10-21)29(35)32-24-13-14-24)33-28(34)23-7-4-8-25(17-23)36-19-20-5-2-1-3-6-20/h1-8,15-18,21-22,24H,9-14,19,30H2/p+1 |
| InChIKey | SHSAJOXGTYYMLN-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|