C19H17N4O+ — CID 87392014
3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87392014) has the molecular formula C19H17N4O+ and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87392014 |
| Molecular Formula | C19H17N4O+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | N[N+]12C=CN=CC1=CN=C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H17N4O/c20-23-10-9-21-12-17(23)13-22-19(23)16-7-4-8-18(11-16)24-14-15-5-2-1-3-6-15/h1-13H,14,20H2/q+1 |
| InChIKey | LEMLDGQZFJUZAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|