C24H21N4O2+ — CID 87391402
[3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methanol (PubChem CID 87391402) has the molecular formula C24H21N4O2+ and a molecular weight of 397.46 g/mol. Its IUPAC name is [3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methanol.
| Compound Name | [3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 87391402 |
| Molecular Formula | C24H21N4O2+ |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [3-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]methanol |
| SMILES | N[N+]12C=CN=CC1=C(C1=CC=C1)N=C2c1cccc(OCc2cccc(CO)c2)c1 |
| InChI | InChI=1S/C24H21N4O2/c25-28-11-10-26-14-22(28)23(19-6-2-7-19)27-24(28)20-8-3-9-21(13-20)30-16-18-5-1-4-17(12-18)15-29/h1-14,29H,15-16,25H2/q+1 |
| InChIKey | KLVPDWJKJLLEHR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|