C27H26N5O3+ — CID 87390793
N-[2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]-2-methoxypropanamide (PubChem CID 87390793) has the molecular formula C27H26N5O3+ and a molecular weight of 468.54 g/mol. Its IUPAC name is N-[2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]-2-methoxypropanamide.
| Compound Name | N-[2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 87390793 |
| Molecular Formula | C27H26N5O3+ |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[2-[[3-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]phenoxy]methyl]phenyl]-2-methoxypropanamide |
| SMILES | COC(C)C(=O)Nc1ccccc1COc1cccc(C2=NC(C3=CC=C3)=C3C=NC=C[N+]23N)c1 |
| InChI | InChI=1S/C27H25N5O3/c1-18(34-2)27(33)30-23-12-4-3-7-21(23)17-35-22-11-6-10-20(15-22)26-31-25(19-8-5-9-19)24-16-29-13-14-32(24,26)28/h3-16,18H,17,28H2,1-2H3/p+1 |
| InChIKey | UCLSKHMEFOHNRF-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|