C25H21N4O2+ — CID 87657060
1-(4-methoxyphenyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87657060) has the molecular formula C25H21N4O2+ and a molecular weight of 409.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-(4-methoxyphenyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87657060 |
| Molecular Formula | C25H21N4O2+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | COc1ccc(C2=C3C=NC=C[N+]3(N)C(c3ccc(Oc4ccccc4)cc3)=N2)cc1 |
| InChI | InChI=1S/C25H21N4O2/c1-30-20-11-7-18(8-12-20)24-23-17-27-15-16-29(23,26)25(28-24)19-9-13-22(14-10-19)31-21-5-3-2-4-6-21/h2-17H,26H2,1H3/q+1 |
| InChIKey | OGCSCJBPTIZVHK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|