C26H25N6+ — CID 87591718
1-[2-(aminomethyl)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87591718) has the molecular formula C26H25N6+ and a molecular weight of 421.53 g/mol. Its IUPAC name is 1-[2-(aminomethyl)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-[2-(aminomethyl)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87591718 |
| Molecular Formula | C26H25N6+ |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 1-[2-(aminomethyl)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | NCC1CCC1C1=C2C=NC=C[N+]2(N)C(c2ccc3ccc(-c4ccccc4)nc3c2)=N1 |
| InChI | InChI=1S/C26H25N6/c27-15-20-8-10-21(20)25-24-16-29-12-13-32(24,28)26(31-25)19-7-6-18-9-11-22(30-23(18)14-19)17-4-2-1-3-5-17/h1-7,9,11-14,16,20-21H,8,10,15,27-28H2/q+1 |
| InChIKey | TUOVTCUBPCEYOJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|