C26H25N6OS+ — CID 87102824
4-[4-amino-3-(2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide (PubChem CID 87102824) has the molecular formula C26H25N6OS+ and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-[4-amino-3-(2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[4-amino-3-(2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87102824 |
| Molecular Formula | C26H25N6OS+ |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-[4-amino-3-(2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(C2=C3C=NC=C[N+]3(N)C(c3ccc4ccc(-c5cccs5)nc4c3)=N2)CC1 |
| InChI | InChI=1S/C26H24N6OS/c27-25(33)18-6-4-17(5-7-18)24-22-15-29-11-12-32(22,28)26(31-24)19-8-3-16-9-10-20(30-21(16)14-19)23-2-1-13-34-23/h1-3,8-15,17-18H,4-7,28H2,(H-,27,33)/p+1 |
| InChIKey | HBHVGZHWRCCTGH-UHFFFAOYSA-O |
| XLogP | 4.47 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|