C23H15ClN5S+ — CID 87102110
3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87102110) has the molecular formula C23H15ClN5S+ and a molecular weight of 428.93 g/mol. Its IUPAC name is 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87102110 |
| Molecular Formula | C23H15ClN5S+ |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | N[N+]12C=CN=CC1=C(C1=CC=C1)N=C2c1cc2nc(-c3cccs3)ccc2cc1Cl |
| InChI | InChI=1S/C23H15ClN5S/c24-17-11-15-6-7-18(21-5-2-10-30-21)27-19(15)12-16(17)23-28-22(14-3-1-4-14)20-13-26-8-9-29(20,23)25/h1-13H,25H2/q+1 |
| InChIKey | KLUQDRBAEGZAQF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|