C26H27N6S+ — CID 91428461
N-[1-[(dimethylamino)methyl]cyclobutyl]-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-2-thiophen-2-ylquinolin-7-amine (PubChem CID 91428461) has the molecular formula C26H27N6S+ and a molecular weight of 455.61 g/mol. Its IUPAC name is N-[1-[(dimethylamino)methyl]cyclobutyl]-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-2-thiophen-2-ylquinolin-7-amine.
| Compound Name | N-[1-[(dimethylamino)methyl]cyclobutyl]-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-2-thiophen-2-ylquinolin-7-amine |
|---|---|
| PubChem CID | 91428461 |
| Molecular Formula | C26H27N6S+ |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[1-[(dimethylamino)methyl]cyclobutyl]-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-2-thiophen-2-ylquinolin-7-amine |
| SMILES | CN(C)CC1(N(c2ccc3ccc(-c4cccs4)nc3c2)[N+]23C=CN=CC2=CN=C3)CCC1 |
| InChI | InChI=1S/C26H27N6S/c1-30(2)18-26(10-4-11-26)31(32-13-12-27-16-22(32)17-28-19-32)21-8-6-20-7-9-23(29-24(20)15-21)25-5-3-14-33-25/h3,5-9,12-17,19H,4,10-11,18H2,1-2H3/q+1 |
| InChIKey | RCAOXLRMCYCHAT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|