C21H17ClN2S2 — CID 19421035
3-chloro-4-(2,6-dithiophen-2-yl-4-pyridinyl)-N,N-dimethylaniline (PubChem CID 19421035) has the molecular formula C21H17ClN2S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 3-chloro-4-(2,6-dithiophen-2-yl-4-pyridinyl)-N,N-dimethylaniline.
| Compound Name | 3-chloro-4-(2,6-dithiophen-2-yl-4-pyridinyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19421035 |
| Molecular Formula | C21H17ClN2S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-chloro-4-(2,6-dithiophen-2-yl-4-pyridinyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cc(-c3cccs3)nc(-c3cccs3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2S2/c1-24(2)15-7-8-16(17(22)13-15)14-11-18(20-5-3-9-25-20)23-19(12-14)21-6-4-10-26-21/h3-13H,1-2H3 |
| InChIKey | CJYZMVBCLHJQED-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |