C26H26ClN6S+ — CID 87102348
3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-[3-[(dimethylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87102348) has the molecular formula C26H26ClN6S+ and a molecular weight of 490.06 g/mol. Its IUPAC name is 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-[3-[(dimethylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-[3-[(dimethylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87102348 |
| Molecular Formula | C26H26ClN6S+ |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 3-(6-chloro-2-thiophen-2-ylquinolin-7-yl)-1-[3-[(dimethylamino)methyl]cyclobutyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CN(C)CC1CC(C2=C3C=NC=C[N+]3(N)C(c3cc4nc(-c5cccs5)ccc4cc3Cl)=N2)C1 |
| InChI | InChI=1S/C26H26ClN6S/c1-32(2)15-16-10-18(11-16)25-23-14-29-7-8-33(23,28)26(31-25)19-13-22-17(12-20(19)27)5-6-21(30-22)24-4-3-9-34-24/h3-9,12-14,16,18H,10-11,15,28H2,1-2H3/q+1 |
| InChIKey | SJCHMOXMYQSHRL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|