C23H19FN5OS+ — CID 87102234
3-[4-amino-3-(8-fluoro-2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol (PubChem CID 87102234) has the molecular formula C23H19FN5OS+ and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[4-amino-3-(8-fluoro-2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol.
| Compound Name | 3-[4-amino-3-(8-fluoro-2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 87102234 |
| Molecular Formula | C23H19FN5OS+ |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-[4-amino-3-(8-fluoro-2-thiophen-2-ylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol |
| SMILES | N[N+]12C=CN=CC1=C(C1CC(O)C1)N=C2c1ccc2ccc(-c3cccs3)nc2c1F |
| InChI | InChI=1S/C23H19FN5OS/c24-20-16(5-3-13-4-6-17(27-22(13)20)19-2-1-9-31-19)23-28-21(14-10-15(30)11-14)18-12-26-7-8-29(18,23)25/h1-9,12,14-15,30H,10-11,25H2/q+1 |
| InChIKey | VIVSPYHXNNPMGX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|