C28H26ClN6O+ — CID 87102483
4-[4-amino-3-(6-chloro-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide (PubChem CID 87102483) has the molecular formula C28H26ClN6O+ and a molecular weight of 498.01 g/mol. Its IUPAC name is 4-[4-amino-3-(6-chloro-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[4-amino-3-(6-chloro-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87102483 |
| Molecular Formula | C28H26ClN6O+ |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 4-[4-amino-3-(6-chloro-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(C2=C3C=NC=C[N+]3(N)C(c3cc4nc(-c5ccccc5)ccc4cc3Cl)=N2)CC1 |
| InChI | InChI=1S/C28H25ClN6O/c29-22-14-20-10-11-23(17-4-2-1-3-5-17)33-24(20)15-21(22)28-34-26(25-16-32-12-13-35(25,28)31)18-6-8-19(9-7-18)27(30)36/h1-5,10-16,18-19H,6-9,31H2,(H-,30,36)/p+1 |
| InChIKey | PDHUHCRQEWUXHE-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|