C26H23FN5O+ — CID 87617306
3-[4-amino-3-(6-fluoro-4-methyl-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol (PubChem CID 87617306) has the molecular formula C26H23FN5O+ and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[4-amino-3-(6-fluoro-4-methyl-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol.
| Compound Name | 3-[4-amino-3-(6-fluoro-4-methyl-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 87617306 |
| Molecular Formula | C26H23FN5O+ |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-[4-amino-3-(6-fluoro-4-methyl-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutan-1-ol |
| SMILES | Cc1cc(-c2ccccc2)nc2cc(C3=NC(C4CC(O)C4)=C4C=NC=C[N+]34N)c(F)cc12 |
| InChI | InChI=1S/C26H23FN5O/c1-15-9-22(16-5-3-2-4-6-16)30-23-13-20(21(27)12-19(15)23)26-31-25(17-10-18(33)11-17)24-14-29-7-8-32(24,26)28/h2-9,12-14,17-18,33H,10-11,28H2,1H3/q+1 |
| InChIKey | ICZQFVBYXOTCNC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|