C28H29N6O+ — CID 87101867
1-[3-(2-methoxyethylamino)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87101867) has the molecular formula C28H29N6O+ and a molecular weight of 465.58 g/mol. Its IUPAC name is 1-[3-(2-methoxyethylamino)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-[3-(2-methoxyethylamino)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87101867 |
| Molecular Formula | C28H29N6O+ |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-[3-(2-methoxyethylamino)cyclobutyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | COCCNC1CC(C2=C3C=NC=C[N+]3(N)C(c3ccc4ccc(-c5ccccc5)nc4c3)=N2)C1 |
| InChI | InChI=1S/C28H29N6O/c1-35-14-12-31-23-15-22(16-23)27-26-18-30-11-13-34(26,29)28(33-27)21-8-7-20-9-10-24(32-25(20)17-21)19-5-3-2-4-6-19/h2-11,13,17-18,22-23,31H,12,14-16,29H2,1H3/q+1 |
| InChIKey | XFYHHRCPTLVTSG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|