C23H23N4O+ — CID 87202947
1-(3-methylcyclobutyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87202947) has the molecular formula C23H23N4O+ and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(3-methylcyclobutyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-(3-methylcyclobutyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87202947 |
| Molecular Formula | C23H23N4O+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-(3-methylcyclobutyl)-3-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CC1CC(C2=C3C=NC=C[N+]3(N)C(c3ccc(Oc4ccccc4)cc3)=N2)C1 |
| InChI | InChI=1S/C23H23N4O/c1-16-13-18(14-16)22-21-15-25-11-12-27(21,24)23(26-22)17-7-9-20(10-8-17)28-19-5-3-2-4-6-19/h2-12,15-16,18H,13-14,24H2,1H3/q+1 |
| InChIKey | WPQLGIFOKCLUFJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|