C30H32N7O2+ — CID 87111325
4-[[3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-hydroxycyclobutyl]methylamino]butanamide (PubChem CID 87111325) has the molecular formula C30H32N7O2+ and a molecular weight of 522.63 g/mol. Its IUPAC name is 4-[[3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-hydroxycyclobutyl]methylamino]butanamide.
| Compound Name | 4-[[3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-hydroxycyclobutyl]methylamino]butanamide |
|---|---|
| PubChem CID | 87111325 |
| Molecular Formula | C30H32N7O2+ |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 4-[[3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-hydroxycyclobutyl]methylamino]butanamide |
| SMILES | NC(=O)CCCNCC1(O)CC(C2=C3C=NC=C[N+]3(N)C(c3ccc4ccc(-c5ccccc5)nc4c3)=N2)C1 |
| InChI | InChI=1S/C30H31N7O2/c31-27(38)7-4-12-34-19-30(39)16-23(17-30)28-26-18-33-13-14-37(26,32)29(36-28)22-9-8-21-10-11-24(35-25(21)15-22)20-5-2-1-3-6-20/h1-3,5-6,8-11,13-15,18,23,34,39H,4,7,12,16-17,19,32H2,(H-,31,38)/p+1 |
| InChIKey | MHFZMMQJKYVNHE-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 138.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|