C25H24N5+ — CID 87102610
1-tert-butyl-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87102610) has the molecular formula C25H24N5+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-tert-butyl-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-tert-butyl-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87102610 |
| Molecular Formula | C25H24N5+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-tert-butyl-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CC(C)(C)C1=C2C=NC=C[N+]2(N)C(c2ccc3ccc(-c4ccccc4)nc3c2)=N1 |
| InChI | InChI=1S/C25H24N5/c1-25(2,3)23-22-16-27-13-14-30(22,26)24(29-23)19-10-9-18-11-12-20(28-21(18)15-19)17-7-5-4-6-8-17/h4-16H,26H2,1-3H3/q+1 |
| InChIKey | LVGKTQLIGCOVCX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|