C29H29N6O+ — CID 87102691
3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-(azetidin-1-ylmethyl)cyclobutan-1-ol (PubChem CID 87102691) has the molecular formula C29H29N6O+ and a molecular weight of 477.59 g/mol. Its IUPAC name is 3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-(azetidin-1-ylmethyl)cyclobutan-1-ol.
| Compound Name | 3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-(azetidin-1-ylmethyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 87102691 |
| Molecular Formula | C29H29N6O+ |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-(azetidin-1-ylmethyl)cyclobutan-1-ol |
| SMILES | N[N+]12C=CN=CC1=C(C1CC(O)(CN3CCC3)C1)N=C2c1ccc2ccc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C29H29N6O/c30-35-14-11-31-18-26(35)27(23-16-29(36,17-23)19-34-12-4-13-34)33-28(35)22-8-7-21-9-10-24(32-25(21)15-22)20-5-2-1-3-6-20/h1-3,5-11,14-15,18,23,36H,4,12-13,16-17,19,30H2/q+1 |
| InChIKey | WQPLWFOJEVKBAX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|