C33H30N5O3S+ — CID 87101952
[3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutyl]methyl 4-methylbenzenesulfonate (PubChem CID 87101952) has the molecular formula C33H30N5O3S+ and a molecular weight of 576.70 g/mol. Its IUPAC name is [3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87101952 |
| Molecular Formula | C33H30N5O3S+ |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [3-[4-amino-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-1-yl]cyclobutyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(C3=C4C=NC=C[N+]4(N)C(c4ccc5ccc(-c6ccccc6)nc5c4)=N3)C2)cc1 |
| InChI | InChI=1S/C33H30N5O3S/c1-22-7-12-28(13-8-22)42(39,40)41-21-23-17-27(18-23)32-31-20-35-15-16-38(31,34)33(37-32)26-10-9-25-11-14-29(36-30(25)19-26)24-5-3-2-4-6-24/h2-16,19-20,23,27H,17-18,21,34H2,1H3/q+1 |
| InChIKey | OMGWYDACJICBHJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|