C28H29N6O2S+ — CID 87471035
1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87471035) has the molecular formula C28H29N6O2S+ and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87471035 |
| Molecular Formula | C28H29N6O2S+ |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 1-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CS(=O)(=O)N1CCC(CC2=C3C=NC=C[N+]3(N)C(c3ccc4ccc(-c5ccccc5)nc4c3)=N2)CC1 |
| InChI | InChI=1S/C28H29N6O2S/c1-37(35,36)33-14-11-20(12-15-33)17-26-27-19-30-13-16-34(27,29)28(32-26)23-8-7-22-9-10-24(31-25(22)18-23)21-5-3-2-4-6-21/h2-10,13,16,18-20H,11-12,14-15,17,29H2,1H3/q+1 |
| InChIKey | IKBTVUOKBJLYCE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|