C24H22N5+ — CID 87102449
3-(2-phenylquinolin-7-yl)-1-propan-2-ylimidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 87102449) has the molecular formula C24H22N5+ and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-(2-phenylquinolin-7-yl)-1-propan-2-ylimidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | 3-(2-phenylquinolin-7-yl)-1-propan-2-ylimidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 87102449 |
| Molecular Formula | C24H22N5+ |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 3-(2-phenylquinolin-7-yl)-1-propan-2-ylimidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CC(C)C1=C2C=NC=C[N+]2(N)C(c2ccc3ccc(-c4ccccc4)nc3c2)=N1 |
| InChI | InChI=1S/C24H22N5/c1-16(2)23-22-15-26-12-13-29(22,25)24(28-23)19-9-8-18-10-11-20(27-21(18)14-19)17-6-4-3-5-7-17/h3-16H,25H2,1-2H3/q+1 |
| InChIKey | GSEFRVNZYVKXPZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|