C24H25N4O3+ — CID 87203022
3-[4-amino-3-(2-methoxy-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-methylcyclobutan-1-ol (PubChem CID 87203022) has the molecular formula C24H25N4O3+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-[4-amino-3-(2-methoxy-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[4-amino-3-(2-methoxy-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 87203022 |
| Molecular Formula | C24H25N4O3+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[4-amino-3-(2-methoxy-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-1-yl]-1-methylcyclobutan-1-ol |
| SMILES | COc1cc(Oc2ccccc2)ccc1C1=NC(C2CC(C)(O)C2)=C2C=NC=C[N+]12N |
| InChI | InChI=1S/C24H25N4O3/c1-24(29)13-16(14-24)22-20-15-26-10-11-28(20,25)23(27-22)19-9-8-18(12-21(19)30-2)31-17-6-4-3-5-7-17/h3-12,15-16,29H,13-14,25H2,1-2H3/q+1 |
| InChIKey | RFOIIGDEVBLRRH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|