C24H19N6S+ — CID 87101743
7-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-methyl-2-thiophen-2-ylquinolin-4-amine (PubChem CID 87101743) has the molecular formula C24H19N6S+ and a molecular weight of 423.53 g/mol. Its IUPAC name is 7-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-methyl-2-thiophen-2-ylquinolin-4-amine.
| Compound Name | 7-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-methyl-2-thiophen-2-ylquinolin-4-amine |
|---|---|
| PubChem CID | 87101743 |
| Molecular Formula | C24H19N6S+ |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 7-[4-amino-1-(cyclobutadienyl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-methyl-2-thiophen-2-ylquinolin-4-amine |
| SMILES | CNc1cc(-c2cccs2)nc2cc(C3=NC(C4=CC=C4)=C4C=NC=C[N+]34N)ccc12 |
| InChI | InChI=1S/C24H19N6S/c1-26-18-13-20(22-6-3-11-31-22)28-19-12-16(7-8-17(18)19)24-29-23(15-4-2-5-15)21-14-27-9-10-30(21,24)25/h2-14H,25H2,1H3,(H,26,28)/q+1 |
| InChIKey | AMURWAFFWPWAOL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|